C17H24O3 — CID 138981963
(1S,5R)-4-methoxy-8,8-dimethyl-7-(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 138981963) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1S,5R)-4-methoxy-8,8-dimethyl-7-(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5R)-4-methoxy-8,8-dimethyl-7-(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 138981963 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (1S,5R)-4-methoxy-8,8-dimethyl-7-(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | COC1=CC(=O)[C@H]2C(=O)[C@@H]1CC(CC=C(C)C)C2(C)C |
| InChI | InChI=1S/C17H24O3/c1-10(2)6-7-11-8-12-14(20-5)9-13(18)15(16(12)19)17(11,3)4/h6,9,11-12,15H,7-8H2,1-5H3/t11?,12-,15+/m1/s1 |
| InChIKey | URLUTIXDWHFZRB-ZCADOIRISA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|