C22H28N6 — CID 138981972
N-[(1,3-diethylbenzimidazol-2-ylidene)amino]-1,3-diethylbenzimidazol-2-imine (PubChem CID 138981972) has the molecular formula C22H28N6 and a molecular weight of 376.51 g/mol. Its IUPAC name is N-[(1,3-diethylbenzimidazol-2-ylidene)amino]-1,3-diethylbenzimidazol-2-imine.
| Compound Name | N-[(1,3-diethylbenzimidazol-2-ylidene)amino]-1,3-diethylbenzimidazol-2-imine |
|---|---|
| PubChem CID | 138981972 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N-[(1,3-diethylbenzimidazol-2-ylidene)amino]-1,3-diethylbenzimidazol-2-imine |
| SMILES | CCn1c(=NN=c2n(CC)c3ccccc3n2CC)n(CC)c2ccccc21 |
| InChI | InChI=1S/C22H28N6/c1-5-25-17-13-9-10-14-18(17)26(6-2)21(25)23-24-22-27(7-3)19-15-11-12-16-20(19)28(22)8-4/h9-16H,5-8H2,1-4H3 |
| InChIKey | BMTWIKVHHSTRPC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|