About 1,3-dibromothieno[3,4-f][1,10]phenanthroline
1,3-dibromothieno[3,4-f][1,10]phenanthroline (PubChem CID 138982030) has the molecular formula C14H6Br2N2S
and a molecular weight of 394.09 g/mol. Its IUPAC name is 1,3-dibromothieno[3,4-f][1,10]phenanthroline.
Molecular Properties
| Compound Name | 1,3-dibromothieno[3,4-f][1,10]phenanthroline |
| PubChem CID | 138982030 |
| Molecular Formula | C14H6Br2N2S |
| Molecular Weight | 394.09 g/mol |
| Exact Mass | 391.86 |
| IUPAC Name | 1,3-dibromothieno[3,4-f][1,10]phenanthroline |
| SMILES | Brc1sc(Br)c2c3cccnc3c3ncccc3c12 |
| InChI | InChI=1S/C14H6Br2N2S/c15-13-9-7-3-1-5-17-11(7)12-8(4-2-6-18-12)10(9)14(16)19-13/h1-6H |
| InChIKey | MIOYPOWZKNKGNJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.09 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromothieno[3,4-f][1,10]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromothieno[3,4-f][1,10]phenanthroline?
The IUPAC name of 1,3-dibromothieno[3,4-f][1,10]phenanthroline (CID 138982030) is 1,3-dibromothieno[3,4-f][1,10]phenanthroline.
What is the SMILES notation for 1,3-dibromothieno[3,4-f][1,10]phenanthroline?
The canonical SMILES for 1,3-dibromothieno[3,4-f][1,10]phenanthroline is Brc1sc(Br)c2c3cccnc3c3ncccc3c12.
What is the InChIKey of 1,3-dibromothieno[3,4-f][1,10]phenanthroline?
The InChIKey is MIOYPOWZKNKGNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Br2N2S/c15-13-9-7-3-1-5-17-11(7)12-8(4-2-6-18-12)10(9)14(16)19-13/h1-6H.
What are the key properties of 1,3-dibromothieno[3,4-f][1,10]phenanthroline?
1,3-dibromothieno[3,4-f][1,10]phenanthroline has a molecular weight of 394.09 g/mol, XLogP of 5.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromothieno[3,4-f][1,10]phenanthroline is sourced from PubChem (CID 138982030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).