C25H55N13+2 — CID 138982106
1,1,3,3-tetramethyl-2-[2,5,6-tris[bis(dimethylamino)methylideneamino]-1,2,3,4,5,6-hexahydropyridin-1-ium-4-ylium-3-yl]guanidine (PubChem CID 138982106) has the molecular formula C25H55N13+2 and a molecular weight of 537.81 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[2,5,6-tris[bis(dimethylamino)methylideneamino]-1,2,3,4,5,6-hexahydropyridin-1-ium-4-ylium-3-yl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[2,5,6-tris[bis(dimethylamino)methylideneamino]-1,2,3,4,5,6-hexahydropyridin-1-ium-4-ylium-3-yl]guanidine |
|---|---|
| PubChem CID | 138982106 |
| Molecular Formula | C25H55N13+2 |
| Molecular Weight | 537.81 g/mol |
| Exact Mass | 537.47 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[2,5,6-tris[bis(dimethylamino)methylideneamino]-1,2,3,4,5,6-hexahydropyridin-1-ium-4-ylium-3-yl]guanidine |
| SMILES | CN(C)C(=NC1[CH+]C(N=C(N(C)C)N(C)C)C(N=C(N(C)C)N(C)C)[NH2+]C1N=C(N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C25H54N13/c1-31(2)22(32(3)4)26-18-17-19(27-23(33(5)6)34(7)8)21(30-25(37(13)14)38(15)16)28-20(18)29-24(35(9)10)36(11)12/h17-21,28H,1-16H3/q+1/p+1 |
| InChIKey | QSOLUBTZIQGMAI-UHFFFAOYSA-O |
| XLogP | -1.93 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.81 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|