About N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide
N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide (PubChem CID 138982128) has the molecular formula C16H24FN3O
and a molecular weight of 293.39 g/mol. Its IUPAC name is N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide |
| PubChem CID | 138982128 |
| Molecular Formula | C16H24FN3O |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide |
| SMILES | CC(C)(C)/N=C(/NC(=O)c1ccc(F)cc1)NC(C)(C)C |
| InChI | InChI=1S/C16H24FN3O/c1-15(2,3)19-14(20-16(4,5)6)18-13(21)11-7-9-12(17)10-8-11/h7-10H,1-6H3,(H2,18,19,20,21) |
| InChIKey | YGQNCCZRGKCGDT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide?
The IUPAC name of N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide (CID 138982128) is N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide.
What is the SMILES notation for N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide?
The canonical SMILES for N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide is CC(C)(C)/N=C(/NC(=O)c1ccc(F)cc1)NC(C)(C)C.
What is the InChIKey of N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide?
The InChIKey is YGQNCCZRGKCGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24FN3O/c1-15(2,3)19-14(20-16(4,5)6)18-13(21)11-7-9-12(17)10-8-11/h7-10H,1-6H3,(H2,18,19,20,21).
What are the key properties of N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide?
N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide has a molecular weight of 293.39 g/mol, XLogP of 3.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N,N'-ditert-butylcarbamimidoyl)-4-fluorobenzamide is sourced from PubChem (CID 138982128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).