C29H19N5 — CID 138982227
2-(2,3,4-tripyridin-2-ylnaphthalen-1-yl)pyrimidine (PubChem CID 138982227) has the molecular formula C29H19N5 and a molecular weight of 437.51 g/mol. Its IUPAC name is 2-(2,3,4-tripyridin-2-ylnaphthalen-1-yl)pyrimidine.
| Compound Name | 2-(2,3,4-tripyridin-2-ylnaphthalen-1-yl)pyrimidine |
|---|---|
| PubChem CID | 138982227 |
| Molecular Formula | C29H19N5 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-(2,3,4-tripyridin-2-ylnaphthalen-1-yl)pyrimidine |
| SMILES | c1ccc(-c2c(-c3ccccn3)c(-c3ncccn3)c3ccccc3c2-c2ccccn2)nc1 |
| InChI | InChI=1S/C29H19N5/c1-2-11-21-20(10-1)25(22-12-3-6-15-30-22)27(23-13-4-7-16-31-23)28(24-14-5-8-17-32-24)26(21)29-33-18-9-19-34-29/h1-19H |
| InChIKey | PCFYTZITCAOAPS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |