C32H25N5 — CID 138982232
2-[2,3,4-tris(4-methyl-2-pyridinyl)naphthalen-1-yl]pyrimidine (PubChem CID 138982232) has the molecular formula C32H25N5 and a molecular weight of 479.59 g/mol. Its IUPAC name is 2-[2,3,4-tris(4-methyl-2-pyridinyl)naphthalen-1-yl]pyrimidine.
| Compound Name | 2-[2,3,4-tris(4-methyl-2-pyridinyl)naphthalen-1-yl]pyrimidine |
|---|---|
| PubChem CID | 138982232 |
| Molecular Formula | C32H25N5 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2-[2,3,4-tris(4-methyl-2-pyridinyl)naphthalen-1-yl]pyrimidine |
| SMILES | Cc1ccnc(-c2c(-c3cc(C)ccn3)c(-c3ncccn3)c3ccccc3c2-c2cc(C)ccn2)c1 |
| InChI | InChI=1S/C32H25N5/c1-20-9-14-33-25(17-20)28-23-7-4-5-8-24(23)29(32-36-12-6-13-37-32)31(27-19-22(3)11-16-35-27)30(28)26-18-21(2)10-15-34-26/h4-19H,1-3H3 |
| InChIKey | CGJISRYIGVNPLK-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |