C16H28O3Si — CID 138982302
2-[(1S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-2-methylidenecyclohex-3-en-1-yl]acetic acid (PubChem CID 138982302) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is 2-[(1S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-2-methylidenecyclohex-3-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-2-methylidenecyclohex-3-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 138982302 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[(1S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-2-methylidenecyclohex-3-en-1-yl]acetic acid |
| SMILES | C=C1C(O[Si](C)(C)C(C)(C)C)=C[C@H](C)C[C@H]1CC(=O)O |
| InChI | InChI=1S/C16H28O3Si/c1-11-8-13(10-15(17)18)12(2)14(9-11)19-20(6,7)16(3,4)5/h9,11,13H,2,8,10H2,1,3-7H3,(H,17,18)/t11-,13+/m1/s1 |
| InChIKey | YEFVVGAANITSSR-YPMHNXCESA-N |
| XLogP | 4.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|