C25H46O6Si — CID 138982495
(3S,3aS,5aS,9aS,9bR)-3-[tert-butyl(dimethyl)silyl]oxy-5a-methoxy-9a-(2-methoxyethoxymethoxy)-3a-methyl-2,3,4,5,6,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one (PubChem CID 138982495) has the molecular formula C25H46O6Si and a molecular weight of 470.72 g/mol. Its IUPAC name is (3S,3aS,5aS,9aS,9bR)-3-[tert-butyl(dimethyl)silyl]oxy-5a-methoxy-9a-(2-methoxyethoxymethoxy)-3a-methyl-2,3,4,5,6,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one.
| Compound Name | (3S,3aS,5aS,9aS,9bR)-3-[tert-butyl(dimethyl)silyl]oxy-5a-methoxy-9a-(2-methoxyethoxymethoxy)-3a-methyl-2,3,4,5,6,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 138982495 |
| Molecular Formula | C25H46O6Si |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | (3S,3aS,5aS,9aS,9bR)-3-[tert-butyl(dimethyl)silyl]oxy-5a-methoxy-9a-(2-methoxyethoxymethoxy)-3a-methyl-2,3,4,5,6,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
| SMILES | COCCOCO[C@]12CCC(=O)C[C@@]1(OC)CC[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]12 |
| InChI | InChI=1S/C25H46O6Si/c1-22(2,3)32(7,8)31-21-10-9-20-23(21,4)13-14-24(28-6)17-19(26)11-12-25(20,24)30-18-29-16-15-27-5/h20-21H,9-18H2,1-8H3/t20-,21+,23+,24+,25+/m1/s1 |
| InChIKey | USCIPVOXOYYTIR-GPXHLONLSA-N |
| XLogP | 5.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|