About [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate
[(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate (PubChem CID 138982623) has the molecular formula C16H28O3Si
and a molecular weight of 296.48 g/mol. Its IUPAC name is [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate.
Molecular Properties
| Compound Name | [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate |
| PubChem CID | 138982623 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC[C@@H](C)C=C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O3Si/c1-12-8-9-14(11-18-13(2)17)15(10-12)19-20(6,7)16(3,4)5/h9-10,12H,8,11H2,1-7H3/t12-/m1/s1 |
| InChIKey | AQKQCBJRGHGYHK-GFCCVEGCSA-N |
| XLogP | 4.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate?
The IUPAC name of [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate (CID 138982623) is [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate.
What is the SMILES notation for [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate?
The canonical SMILES for [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate is CC(=O)OCC1=CC[C@@H](C)C=C1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate?
The InChIKey is AQKQCBJRGHGYHK-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H28O3Si/c1-12-8-9-14(11-18-13(2)17)15(10-12)19-20(6,7)16(3,4)5/h9-10,12H,8,11H2,1-7H3/t12-/m1/s1.
What are the key properties of [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate?
[(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate has a molecular weight of 296.48 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohexa-1,5-dien-1-yl]methyl acetate is sourced from PubChem (CID 138982623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).