C17H25NO8 — CID 138982637
[(3S,6R)-5-acetamido-3,4-diacetyloxy-6-prop-2-enyloxan-2-yl]methyl acetate (PubChem CID 138982637) has the molecular formula C17H25NO8 and a molecular weight of 371.39 g/mol. Its IUPAC name is [(3S,6R)-5-acetamido-3,4-diacetyloxy-6-prop-2-enyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,6R)-5-acetamido-3,4-diacetyloxy-6-prop-2-enyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138982637 |
| Molecular Formula | C17H25NO8 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [(3S,6R)-5-acetamido-3,4-diacetyloxy-6-prop-2-enyloxan-2-yl]methyl acetate |
| SMILES | C=CC[C@H]1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1NC(C)=O |
| InChI | InChI=1S/C17H25NO8/c1-6-7-13-15(18-9(2)19)17(25-12(5)22)16(24-11(4)21)14(26-13)8-23-10(3)20/h6,13-17H,1,7-8H2,2-5H3,(H,18,19)/t13-,14?,15?,16-,17?/m1/s1 |
| InChIKey | OOXMXCKVYWWEGG-HHPWFTGOSA-N |
| XLogP | 0.26 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|