C25H29NO5 — CID 138982648
N-[(6R,8aS)-2-phenyl-8-phenylmethoxy-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 138982648) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-[(6R,8aS)-2-phenyl-8-phenylmethoxy-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(6R,8aS)-2-phenyl-8-phenylmethoxy-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 138982648 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[(6R,8aS)-2-phenyl-8-phenylmethoxy-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | C=CC[C@H]1OC2COC(c3ccccc3)O[C@H]2C(OCc2ccccc2)C1NC(C)=O |
| InChI | InChI=1S/C25H29NO5/c1-3-10-20-22(26-17(2)27)24(28-15-18-11-6-4-7-12-18)23-21(30-20)16-29-25(31-23)19-13-8-5-9-14-19/h3-9,11-14,20-25H,1,10,15-16H2,2H3,(H,26,27)/t20-,21?,22?,23-,24?,25?/m1/s1 |
| InChIKey | JLZHHASVSHDIMT-KTNNQIPISA-N |
| XLogP | 3.53 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|