C35H48O5SSi — CID 138982694
(3R,6S)-4,5-bis(phenylmethoxy)-6-phenylsulfanyl-2-[tri(propan-2-yl)silyloxymethyl]oxan-3-ol (PubChem CID 138982694) has the molecular formula C35H48O5SSi and a molecular weight of 608.92 g/mol. Its IUPAC name is (3R,6S)-4,5-bis(phenylmethoxy)-6-phenylsulfanyl-2-[tri(propan-2-yl)silyloxymethyl]oxan-3-ol.
| Compound Name | (3R,6S)-4,5-bis(phenylmethoxy)-6-phenylsulfanyl-2-[tri(propan-2-yl)silyloxymethyl]oxan-3-ol |
|---|---|
| PubChem CID | 138982694 |
| Molecular Formula | C35H48O5SSi |
| Molecular Weight | 608.92 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | (3R,6S)-4,5-bis(phenylmethoxy)-6-phenylsulfanyl-2-[tri(propan-2-yl)silyloxymethyl]oxan-3-ol |
| SMILES | CC(C)[Si](OCC1O[C@@H](Sc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)[C@@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H48O5SSi/c1-25(2)42(26(3)4,27(5)6)39-24-31-32(36)33(37-22-28-16-10-7-11-17-28)34(38-23-29-18-12-8-13-19-29)35(40-31)41-30-20-14-9-15-21-30/h7-21,25-27,31-36H,22-24H2,1-6H3/t31?,32-,33?,34?,35+/m1/s1 |
| InChIKey | GDAKPGXKXICIPT-TWNSUFICSA-N |
| XLogP | 8.23 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.92 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|