C19H22F3NO2 — CID 138982706
4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)isoquinoline-1,3-dione (PubChem CID 138982706) has the molecular formula C19H22F3NO2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)isoquinoline-1,3-dione.
| Compound Name | 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 138982706 |
| Molecular Formula | C19H22F3NO2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)isoquinoline-1,3-dione |
| SMILES | CN1C(=O)c2ccc(C(F)(F)F)cc2C(C)(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C19H22F3NO2/c1-18(11-12-6-4-3-5-7-12)15-10-13(19(20,21)22)8-9-14(15)16(24)23(2)17(18)25/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | KKSYNJIPKUSGHC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|