C14H28OSi — CID 138982734
tert-butyl-dimethyl-[(3R,4E,6Z)-octa-4,6-dien-3-yl]oxysilane (PubChem CID 138982734) has the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,4E,6Z)-octa-4,6-dien-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,4E,6Z)-octa-4,6-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 138982734 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,4E,6Z)-octa-4,6-dien-3-yl]oxysilane |
| SMILES | C/C=C\C=C\[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28OSi/c1-8-10-11-12-13(9-2)15-16(6,7)14(3,4)5/h8,10-13H,9H2,1-7H3/b10-8-,12-11+/t13-/m1/s1 |
| InChIKey | LETOHMMIOBIPPU-YWJFPXSNSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|