C22H11BF12N2O2 — CID 138982776
2-pyridin-2-yl-5-[2-[4,4,5,5-tetrakis(trifluoromethyl)-1,3,2-dioxaborolan-2-yl]phenyl]pyridine (PubChem CID 138982776) has the molecular formula C22H11BF12N2O2 and a molecular weight of 574.13 g/mol. Its IUPAC name is 2-pyridin-2-yl-5-[2-[4,4,5,5-tetrakis(trifluoromethyl)-1,3,2-dioxaborolan-2-yl]phenyl]pyridine.
| Compound Name | 2-pyridin-2-yl-5-[2-[4,4,5,5-tetrakis(trifluoromethyl)-1,3,2-dioxaborolan-2-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 138982776 |
| Molecular Formula | C22H11BF12N2O2 |
| Molecular Weight | 574.13 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | 2-pyridin-2-yl-5-[2-[4,4,5,5-tetrakis(trifluoromethyl)-1,3,2-dioxaborolan-2-yl]phenyl]pyridine |
| SMILES | FC(F)(F)C1(C(F)(F)F)OB(c2ccccc2-c2ccc(-c3ccccn3)nc2)OC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H11BF12N2O2/c24-19(25,26)17(20(27,28)29)18(21(30,31)32,22(33,34)35)39-23(38-17)14-6-2-1-5-13(14)12-8-9-16(37-11-12)15-7-3-4-10-36-15/h1-11H |
| InChIKey | YZSSNDOYVHLBOU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.13 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|