C30H25NO3 — CID 138982800
2'-phenylspiro[3,4-dihydronaphthalene-1,7'-3a,4,6,8,10,10a-hexahydroindeno[5,6-f]isoindole]-1',2,3'-trione (PubChem CID 138982800) has the molecular formula C30H25NO3 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2'-phenylspiro[3,4-dihydronaphthalene-1,7'-3a,4,6,8,10,10a-hexahydroindeno[5,6-f]isoindole]-1',2,3'-trione.
| Compound Name | 2'-phenylspiro[3,4-dihydronaphthalene-1,7'-3a,4,6,8,10,10a-hexahydroindeno[5,6-f]isoindole]-1',2,3'-trione |
|---|---|
| PubChem CID | 138982800 |
| Molecular Formula | C30H25NO3 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2'-phenylspiro[3,4-dihydronaphthalene-1,7'-3a,4,6,8,10,10a-hexahydroindeno[5,6-f]isoindole]-1',2,3'-trione |
| SMILES | O=C1C2Cc3cc4c(cc3CC2C(=O)N1c1ccccc1)CC1(C4)C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C30H25NO3/c32-27-11-10-18-6-4-5-9-26(18)30(27)16-21-12-19-14-24-25(15-20(19)13-22(21)17-30)29(34)31(28(24)33)23-7-2-1-3-8-23/h1-9,12-13,24-25H,10-11,14-17H2 |
| InChIKey | PYBVVDJNNWRHDZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|