C22H26N2O3 — CID 138982873
3-(4-hydroxybutyl)-1'-methoxy-5,5-dimethylspiro[7H-cyclopenta[c]pyridine-6,3'-indole]-2'-one (PubChem CID 138982873) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)-1'-methoxy-5,5-dimethylspiro[7H-cyclopenta[c]pyridine-6,3'-indole]-2'-one.
| Compound Name | 3-(4-hydroxybutyl)-1'-methoxy-5,5-dimethylspiro[7H-cyclopenta[c]pyridine-6,3'-indole]-2'-one |
|---|---|
| PubChem CID | 138982873 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-(4-hydroxybutyl)-1'-methoxy-5,5-dimethylspiro[7H-cyclopenta[c]pyridine-6,3'-indole]-2'-one |
| SMILES | CON1C(=O)C2(Cc3cnc(CCCCO)cc3C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C22H26N2O3/c1-21(2)18-12-16(8-6-7-11-25)23-14-15(18)13-22(21)17-9-4-5-10-19(17)24(27-3)20(22)26/h4-5,9-10,12,14,25H,6-8,11,13H2,1-3H3 |
| InChIKey | MIOJAMZJKCZMMB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|