About 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine
1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine (PubChem CID 138983005) has the molecular formula C22H48NO3P
and a molecular weight of 405.60 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine |
| PubChem CID | 138983005 |
| Molecular Formula | C22H48NO3P |
| Molecular Weight | 405.60 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine |
| SMILES | CCCCCCN(CCCCCC)C(CCCCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C22H48NO3P/c1-6-11-14-17-20-23(21-18-15-12-7-2)22(19-16-13-8-3)27(24,25-9-4)26-10-5/h22H,6-21H2,1-5H3 |
| InChIKey | YYKKEXJOYKCCJA-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.60 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine?
The IUPAC name of 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine (CID 138983005) is 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine.
What is the SMILES notation for 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine?
The canonical SMILES for 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine is CCCCCCN(CCCCCC)C(CCCCC)P(=O)(OCC)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine?
The InChIKey is YYKKEXJOYKCCJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48NO3P/c1-6-11-14-17-20-23(21-18-15-12-7-2)22(19-16-13-8-3)27(24,25-9-4)26-10-5/h22H,6-21H2,1-5H3.
What are the key properties of 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine?
1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine has a molecular weight of 405.60 g/mol, XLogP of 7.62, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-N,N-dihexylhexan-1-amine is sourced from PubChem (CID 138983005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).