C18H16O2 — CID 138983109
methyl (E)-2-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]-3-phenylprop-2-enoate (PubChem CID 138983109) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl (E)-2-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]-3-phenylprop-2-enoate.
| Compound Name | methyl (E)-2-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 138983109 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | methyl (E)-2-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]-3-phenylprop-2-enoate |
| SMILES | C=c1cccc/c1=C/C(=C\c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H16O2/c1-14-8-6-7-11-16(14)13-17(18(19)20-2)12-15-9-4-3-5-10-15/h3-13H,1H2,2H3/b16-13-,17-12+ |
| InChIKey | GFLSNPCNGQGEPE-NAAPFNDISA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|