About (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate
(1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate (PubChem CID 138983580) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate.
Molecular Properties
| Compound Name | (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate |
| PubChem CID | 138983580 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate |
| SMILES | CC(C)(C)N1C=C[NH+](C(C)(C)C)C1C([O-])O |
| InChI | InChI=1S/C12H23N2O2/c1-11(2,3)13-7-8-14(12(4,5)6)9(13)10(15)16/h7-10,15H,1-6H3/q-1/p+1 |
| InChIKey | RRUNUOPDPKBBPB-UHFFFAOYSA-O |
| XLogP | -0.74 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate?
The IUPAC name of (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate (CID 138983580) is (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate.
What is the SMILES notation for (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate?
The canonical SMILES for (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate is CC(C)(C)N1C=C[NH+](C(C)(C)C)C1C([O-])O.
What is the InChIKey of (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate?
The InChIKey is RRUNUOPDPKBBPB-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H23N2O2/c1-11(2,3)13-7-8-14(12(4,5)6)9(13)10(15)16/h7-10,15H,1-6H3/q-1/p+1.
What are the key properties of (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate?
(1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate has a molecular weight of 228.34 g/mol, XLogP of -0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-ditert-butyl-1,2-dihydroimidazol-1-ium-2-yl)-hydroxymethanolate is sourced from PubChem (CID 138983580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).