C22H30O4 — CID 138983596
(2R)-2-[2-[(4R,5R,7aR)-7a-ethynyl-4,5-dimethylspiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-yl]-2-oxoethyl]-2-methylbut-3-enal (PubChem CID 138983596) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2R)-2-[2-[(4R,5R,7aR)-7a-ethynyl-4,5-dimethylspiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-yl]-2-oxoethyl]-2-methylbut-3-enal.
| Compound Name | (2R)-2-[2-[(4R,5R,7aR)-7a-ethynyl-4,5-dimethylspiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-yl]-2-oxoethyl]-2-methylbut-3-enal |
|---|---|
| PubChem CID | 138983596 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (2R)-2-[2-[(4R,5R,7aR)-7a-ethynyl-4,5-dimethylspiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-yl]-2-oxoethyl]-2-methylbut-3-enal |
| SMILES | C#C[C@@]12CC[C@@H](C)[C@@](C)(C(=O)C[C@](C)(C=C)C=O)C1C1(CC2)OCCO1 |
| InChI | InChI=1S/C22H30O4/c1-6-19(4,15-23)14-17(24)20(5)16(3)8-9-21(7-2)10-11-22(18(20)21)25-12-13-26-22/h2,6,15-16,18H,1,8-14H2,3-5H3/t16-,18?,19+,20+,21+/m1/s1 |
| InChIKey | IWSGAFSWFRXOGC-OPUNKJRVSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|