C17H21O4- — CID 138983700
(1R,3R,4S,12S)-1-methoxy-3,5,10,11,12-pentamethyl-7-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,8,10-trien-9-olate (PubChem CID 138983700) has the molecular formula C17H21O4- and a molecular weight of 289.35 g/mol. Its IUPAC name is (1R,3R,4S,12S)-1-methoxy-3,5,10,11,12-pentamethyl-7-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,8,10-trien-9-olate.
| Compound Name | (1R,3R,4S,12S)-1-methoxy-3,5,10,11,12-pentamethyl-7-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,8,10-trien-9-olate |
|---|---|
| PubChem CID | 138983700 |
| Molecular Formula | C17H21O4- |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (1R,3R,4S,12S)-1-methoxy-3,5,10,11,12-pentamethyl-7-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,8,10-trien-9-olate |
| SMILES | CO[C@@]12O[C@H](C)[C@H]3C(C)=CC(=O)C(=C([O-])C(C)=C1C)[C@]32C |
| InChI | InChI=1S/C17H22O4/c1-8-7-12(18)14-15(19)9(2)10(3)17(20-6)16(14,5)13(8)11(4)21-17/h7,11,13,19H,1-6H3/p-1/t11-,13-,16+,17-/m1/s1 |
| InChIKey | GFSOPPXIQAIDTI-HQQPKKBNSA-M |
| XLogP | 1.86 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |