About 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline
1-(cyclohexylmethyl)imidazo[1,5-a]quinoline (PubChem CID 138983726) has the molecular formula C18H20N2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline |
| PubChem CID | 138983726 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline |
| SMILES | c1ccc2c(c1)ccc1cnc(CC3CCCCC3)n12 |
| InChI | InChI=1S/C18H20N2/c1-2-6-14(7-3-1)12-18-19-13-16-11-10-15-8-4-5-9-17(15)20(16)18/h4-5,8-11,13-14H,1-3,6-7,12H2 |
| InChIKey | MYRGGQWXSVGFBC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline?
The IUPAC name of 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline (CID 138983726) is 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline.
What is the SMILES notation for 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline?
The canonical SMILES for 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline is c1ccc2c(c1)ccc1cnc(CC3CCCCC3)n12.
What is the InChIKey of 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline?
The InChIKey is MYRGGQWXSVGFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2/c1-2-6-14(7-3-1)12-18-19-13-16-11-10-15-8-4-5-9-17(15)20(16)18/h4-5,8-11,13-14H,1-3,6-7,12H2.
What are the key properties of 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline?
1-(cyclohexylmethyl)imidazo[1,5-a]quinoline has a molecular weight of 264.37 g/mol, XLogP of 4.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)imidazo[1,5-a]quinoline is sourced from PubChem (CID 138983726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).