C54H58N2O10 — CID 138983867
benzyl N-[(2S)-1-hydroxy-4-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 138983867) has the molecular formula C54H58N2O10 and a molecular weight of 895.06 g/mol. Its IUPAC name is benzyl N-[(2S)-1-hydroxy-4-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(2S)-1-hydroxy-4-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 138983867 |
| Molecular Formula | C54H58N2O10 |
| Molecular Weight | 895.06 g/mol |
| Exact Mass | 894.41 |
| IUPAC Name | benzyl N-[(2S)-1-hydroxy-4-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | O=C(NN(C(=O)OCc1ccccc1)[C@H](CO)CCC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C54H58N2O10/c57-33-47(56(54(59)65-39-46-29-17-6-18-30-46)55-53(58)64-38-45-27-15-5-16-28-45)31-32-48-50(61-35-42-21-9-2-10-22-42)52(63-37-44-25-13-4-14-26-44)51(62-36-43-23-11-3-12-24-43)49(66-48)40-60-34-41-19-7-1-8-20-41/h1-30,47-52,57H,31-40H2,(H,55,58)/t47-,48?,49?,50?,51?,52?/m0/s1 |
| InChIKey | YRPYBSICLJDISO-YZZYJQOCSA-N |
| XLogP | 9.35 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.06 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|