About 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene
2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene (PubChem CID 138983883) has the molecular formula C8H6BrF2NO2
and a molecular weight of 266.04 g/mol. Its IUPAC name is 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene.
Molecular Properties
| Compound Name | 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene |
| PubChem CID | 138983883 |
| Molecular Formula | C8H6BrF2NO2 |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 264.95 |
| IUPAC Name | 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc([C@H](F)CF)cc1Br |
| InChI | InChI=1S/C8H6BrF2NO2/c9-6-3-5(7(11)4-10)1-2-8(6)12(13)14/h1-3,7H,4H2/t7-/m1/s1 |
| InChIKey | PSQQYIRKTIDFKR-SSDOTTSWSA-N |
| XLogP | 3.34 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene?
The IUPAC name of 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene (CID 138983883) is 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene.
What is the SMILES notation for 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene?
The canonical SMILES for 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene is O=[N+]([O-])c1ccc([C@H](F)CF)cc1Br.
What is the InChIKey of 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene?
The InChIKey is PSQQYIRKTIDFKR-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H6BrF2NO2/c9-6-3-5(7(11)4-10)1-2-8(6)12(13)14/h1-3,7H,4H2/t7-/m1/s1.
What are the key properties of 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene?
2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene has a molecular weight of 266.04 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[(1S)-1,2-difluoroethyl]-1-nitrobenzene is sourced from PubChem (CID 138983883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).