C16H18O4S — CID 138984017
(1S,2R,5R)-1-(benzenesulfonyl)spiro[3-oxabicyclo[3.1.0]hexane-2,7'-5,6-dihydro-2H-oxepine] (PubChem CID 138984017) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is (1S,2R,5R)-1-(benzenesulfonyl)spiro[3-oxabicyclo[3.1.0]hexane-2,7'-5,6-dihydro-2H-oxepine].
| Compound Name | (1S,2R,5R)-1-(benzenesulfonyl)spiro[3-oxabicyclo[3.1.0]hexane-2,7'-5,6-dihydro-2H-oxepine] |
|---|---|
| PubChem CID | 138984017 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (1S,2R,5R)-1-(benzenesulfonyl)spiro[3-oxabicyclo[3.1.0]hexane-2,7'-5,6-dihydro-2H-oxepine] |
| SMILES | O=S(=O)(c1ccccc1)[C@@]12C[C@@H]1CO[C@]21CCC=CCO1 |
| InChI | InChI=1S/C16H18O4S/c17-21(18,14-7-3-1-4-8-14)15-11-13(15)12-20-16(15)9-5-2-6-10-19-16/h1-4,6-8,13H,5,9-12H2/t13-,15+,16-/m1/s1 |
| InChIKey | KHXSPVLKFKQUFC-VNQPRFMTSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|