C20H22N2O3S — CID 138984083
N-butyl-N-(2-phenyl-1,4-benzoxazepin-3-yl)methanesulfonamide (PubChem CID 138984083) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-butyl-N-(2-phenyl-1,4-benzoxazepin-3-yl)methanesulfonamide.
| Compound Name | N-butyl-N-(2-phenyl-1,4-benzoxazepin-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 138984083 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-butyl-N-(2-phenyl-1,4-benzoxazepin-3-yl)methanesulfonamide |
| SMILES | CCCCN(C1=C(c2ccccc2)Oc2ccccc2C=N1)S(C)(=O)=O |
| InChI | InChI=1S/C20H22N2O3S/c1-3-4-14-22(26(2,23)24)20-19(16-10-6-5-7-11-16)25-18-13-9-8-12-17(18)15-21-20/h5-13,15H,3-4,14H2,1-2H3 |
| InChIKey | GXAKMCNMLNTJLE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |