C31H45ClN2O3Si — CID 138984300
tert-butyl N-[3-chloro-5-[2-tri(propan-2-yl)silylethynyl]phenyl]-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]carbamate (PubChem CID 138984300) has the molecular formula C31H45ClN2O3Si and a molecular weight of 557.25 g/mol. Its IUPAC name is tert-butyl N-[3-chloro-5-[2-tri(propan-2-yl)silylethynyl]phenyl]-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl N-[3-chloro-5-[2-tri(propan-2-yl)silylethynyl]phenyl]-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 138984300 |
| Molecular Formula | C31H45ClN2O3Si |
| Molecular Weight | 557.25 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | tert-butyl N-[3-chloro-5-[2-tri(propan-2-yl)silylethynyl]phenyl]-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]carbamate |
| SMILES | COc1c(C)cnc(CN(C(=O)OC(C)(C)C)c2cc(Cl)cc(C#C[Si](C(C)C)(C(C)C)C(C)C)c2)c1C |
| InChI | InChI=1S/C31H45ClN2O3Si/c1-20(2)38(21(3)4,22(5)6)14-13-25-15-26(32)17-27(16-25)34(30(35)37-31(9,10)11)19-28-24(8)29(36-12)23(7)18-33-28/h15-18,20-22H,19H2,1-12H3 |
| InChIKey | ZKJVQSZRUSMYLB-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.25 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|