C26H46O4Sn — CID 138984479
ethyl 2-[(1S,4S,5S,8S)-11-(tributylstannylmethylidene)-3,9-dioxatricyclo[6.3.0.01,5]undecan-4-yl]acetate (PubChem CID 138984479) has the molecular formula C26H46O4Sn and a molecular weight of 541.36 g/mol. Its IUPAC name is ethyl 2-[(1S,4S,5S,8S)-11-(tributylstannylmethylidene)-3,9-dioxatricyclo[6.3.0.01,5]undecan-4-yl]acetate.
| Compound Name | ethyl 2-[(1S,4S,5S,8S)-11-(tributylstannylmethylidene)-3,9-dioxatricyclo[6.3.0.01,5]undecan-4-yl]acetate |
|---|---|
| PubChem CID | 138984479 |
| Molecular Formula | C26H46O4Sn |
| Molecular Weight | 541.36 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | ethyl 2-[(1S,4S,5S,8S)-11-(tributylstannylmethylidene)-3,9-dioxatricyclo[6.3.0.01,5]undecan-4-yl]acetate |
| SMILES | CCCC[Sn](C=C1CO[C@H]2CC[C@@H]3[C@H](CC(=O)OCC)OC[C@]123)(CCCC)CCCC |
| InChI | InChI=1S/C14H19O4.3C4H9.Sn/c1-3-16-13(15)6-11-10-4-5-12-14(10,8-18-11)9(2)7-17-12;3*1-3-4-2;/h2,10-12H,3-8H2,1H3;3*1,3-4H2,2H3;/t10-,11+,12+,14-;;;;/m1..../s1 |
| InChIKey | LIQNCQWGWZSYRK-BIFQAXGFSA-N |
| XLogP | 6.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.36 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |