C18H35BrOSi — CID 138984604
[(2E)-2-bromo-5,9-dimethyldeca-2,8-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 138984604) has the molecular formula C18H35BrOSi and a molecular weight of 375.47 g/mol. Its IUPAC name is [(2E)-2-bromo-5,9-dimethyldeca-2,8-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2E)-2-bromo-5,9-dimethyldeca-2,8-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 138984604 |
| Molecular Formula | C18H35BrOSi |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(2E)-2-bromo-5,9-dimethyldeca-2,8-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)=CCCC(C)C/C=C(/Br)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35BrOSi/c1-15(2)10-9-11-16(3)12-13-17(19)14-20-21(7,8)18(4,5)6/h10,13,16H,9,11-12,14H2,1-8H3/b17-13+ |
| InChIKey | ONDDYDPWONQIIR-GHRIWEEISA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|