C12H7NOS — CID 138984926
3-oxa-13-thia-8-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene (PubChem CID 138984926) has the molecular formula C12H7NOS and a molecular weight of 213.26 g/mol. Its IUPAC name is 3-oxa-13-thia-8-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene.
| Compound Name | 3-oxa-13-thia-8-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene |
|---|---|
| PubChem CID | 138984926 |
| Molecular Formula | C12H7NOS |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3-oxa-13-thia-8-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene |
| SMILES | c1cc2c([nH]1)c1ccoc1c1ccsc21 |
| InChI | InChI=1S/C12H7NOS/c1-4-13-10-7-2-5-14-11(7)9-3-6-15-12(9)8(1)10/h1-6,13H |
| InChIKey | QSJWLTILIGCZBN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |