C12H15NOS — CID 138985159
(2R,3R)-2-methyl-3-phenylthiolane-2-carboxamide (PubChem CID 138985159) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-phenylthiolane-2-carboxamide.
| Compound Name | (2R,3R)-2-methyl-3-phenylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 138985159 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (2R,3R)-2-methyl-3-phenylthiolane-2-carboxamide |
| SMILES | C[C@@]1(C(N)=O)SCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H15NOS/c1-12(11(13)14)10(7-8-15-12)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H2,13,14)/t10-,12-/m1/s1 |
| InChIKey | HKQSPZGVTJGUCF-ZYHUDNBSSA-N |
| XLogP | 2.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |