C21H19FO4 — CID 138985165
dimethyl (2S)-5-fluoro-2-[(E)-2-phenylethenyl]-2,3-dihydroindene-1,1-dicarboxylate (PubChem CID 138985165) has the molecular formula C21H19FO4 and a molecular weight of 354.38 g/mol. Its IUPAC name is dimethyl (2S)-5-fluoro-2-[(E)-2-phenylethenyl]-2,3-dihydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl (2S)-5-fluoro-2-[(E)-2-phenylethenyl]-2,3-dihydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 138985165 |
| Molecular Formula | C21H19FO4 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | dimethyl (2S)-5-fluoro-2-[(E)-2-phenylethenyl]-2,3-dihydroindene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)c2ccc(F)cc2C[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H19FO4/c1-25-19(23)21(20(24)26-2)16(9-8-14-6-4-3-5-7-14)12-15-13-17(22)10-11-18(15)21/h3-11,13,16H,12H2,1-2H3/b9-8+/t16-/m1/s1 |
| InChIKey | PQUXQYXLOUUAPC-ROJDOSBLSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|