About 4-ethynyl-N,3-dimethylaniline
4-ethynyl-N,3-dimethylaniline (PubChem CID 138985683) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 4-ethynyl-N,3-dimethylaniline.
Molecular Properties
| Compound Name | 4-ethynyl-N,3-dimethylaniline |
| PubChem CID | 138985683 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 4-ethynyl-N,3-dimethylaniline |
| SMILES | C#Cc1ccc(NC)cc1C |
| InChI | InChI=1S/C10H11N/c1-4-9-5-6-10(11-3)7-8(9)2/h1,5-7,11H,2-3H3 |
| InChIKey | GAPKIUGHAGXAMN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-N,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-N,3-dimethylaniline?
The IUPAC name of 4-ethynyl-N,3-dimethylaniline (CID 138985683) is 4-ethynyl-N,3-dimethylaniline.
What is the SMILES notation for 4-ethynyl-N,3-dimethylaniline?
The canonical SMILES for 4-ethynyl-N,3-dimethylaniline is C#Cc1ccc(NC)cc1C.
What is the InChIKey of 4-ethynyl-N,3-dimethylaniline?
The InChIKey is GAPKIUGHAGXAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-4-9-5-6-10(11-3)7-8(9)2/h1,5-7,11H,2-3H3.
What are the key properties of 4-ethynyl-N,3-dimethylaniline?
4-ethynyl-N,3-dimethylaniline has a molecular weight of 145.20 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-N,3-dimethylaniline is sourced from PubChem (CID 138985683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).