About 5-ethynyl-N,6-dimethylpyridin-3-amine
5-ethynyl-N,6-dimethylpyridin-3-amine (PubChem CID 138985704) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-ethynyl-N,6-dimethylpyridin-3-amine.
Molecular Properties
| Compound Name | 5-ethynyl-N,6-dimethylpyridin-3-amine |
| PubChem CID | 138985704 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 5-ethynyl-N,6-dimethylpyridin-3-amine |
| SMILES | C#Cc1cc(NC)cnc1C |
| InChI | InChI=1S/C9H10N2/c1-4-8-5-9(10-3)6-11-7(8)2/h1,5-6,10H,2-3H3 |
| InChIKey | FVAPHARPLNZURF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-N,6-dimethylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-N,6-dimethylpyridin-3-amine?
The IUPAC name of 5-ethynyl-N,6-dimethylpyridin-3-amine (CID 138985704) is 5-ethynyl-N,6-dimethylpyridin-3-amine.
What is the SMILES notation for 5-ethynyl-N,6-dimethylpyridin-3-amine?
The canonical SMILES for 5-ethynyl-N,6-dimethylpyridin-3-amine is C#Cc1cc(NC)cnc1C.
What is the InChIKey of 5-ethynyl-N,6-dimethylpyridin-3-amine?
The InChIKey is FVAPHARPLNZURF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-4-8-5-9(10-3)6-11-7(8)2/h1,5-6,10H,2-3H3.
What are the key properties of 5-ethynyl-N,6-dimethylpyridin-3-amine?
5-ethynyl-N,6-dimethylpyridin-3-amine has a molecular weight of 146.19 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-N,6-dimethylpyridin-3-amine is sourced from PubChem (CID 138985704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).