About 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine
4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine (PubChem CID 138986301) has the molecular formula C9H6BrF2IN2
and a molecular weight of 386.97 g/mol. Its IUPAC name is 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine |
| PubChem CID | 138986301 |
| Molecular Formula | C9H6BrF2IN2 |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 385.87 |
| IUPAC Name | 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine |
| SMILES | FC(F)Cn1cc(I)c2c(Br)ccnc21 |
| InChI | InChI=1S/C9H6BrF2IN2/c10-5-1-2-14-9-8(5)6(13)3-15(9)4-7(11)12/h1-3,7H,4H2 |
| InChIKey | CDCXQPJCGPRZKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine?
The IUPAC name of 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine (CID 138986301) is 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine.
What is the SMILES notation for 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine?
The canonical SMILES for 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine is FC(F)Cn1cc(I)c2c(Br)ccnc21.
What is the InChIKey of 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine?
The InChIKey is CDCXQPJCGPRZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF2IN2/c10-5-1-2-14-9-8(5)6(13)3-15(9)4-7(11)12/h1-3,7H,4H2.
What are the key properties of 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine?
4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine has a molecular weight of 386.97 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(2,2-difluoroethyl)-3-iodopyrrolo[2,3-b]pyridine is sourced from PubChem (CID 138986301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).