C12H21NO2 — CID 138986360
4-[cyclopropylmethyl(methyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 138986360) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 4-[cyclopropylmethyl(methyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[cyclopropylmethyl(methyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 138986360 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 4-[cyclopropylmethyl(methyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CN(CC1CC1)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H21NO2/c1-13(8-9-2-3-9)11-6-4-10(5-7-11)12(14)15/h9-11H,2-8H2,1H3,(H,14,15) |
| InChIKey | NGKCNVRUEXRJLM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |