About N-(2-methylpropyl)deca-1,3,5-trien-1-amine
N-(2-methylpropyl)deca-1,3,5-trien-1-amine (PubChem CID 138986911) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is N-(2-methylpropyl)deca-1,3,5-trien-1-amine.
Molecular Properties
| Compound Name | N-(2-methylpropyl)deca-1,3,5-trien-1-amine |
| PubChem CID | 138986911 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-(2-methylpropyl)deca-1,3,5-trien-1-amine |
| SMILES | CCCCC=CC=CC=CNCC(C)C |
| InChI | InChI=1S/C14H25N/c1-4-5-6-7-8-9-10-11-12-15-13-14(2)3/h7-12,14-15H,4-6,13H2,1-3H3 |
| InChIKey | VCFUJQSDZFFBMM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpropyl)deca-1,3,5-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)deca-1,3,5-trien-1-amine?
The IUPAC name of N-(2-methylpropyl)deca-1,3,5-trien-1-amine (CID 138986911) is N-(2-methylpropyl)deca-1,3,5-trien-1-amine.
What is the SMILES notation for N-(2-methylpropyl)deca-1,3,5-trien-1-amine?
The canonical SMILES for N-(2-methylpropyl)deca-1,3,5-trien-1-amine is CCCCC=CC=CC=CNCC(C)C.
What is the InChIKey of N-(2-methylpropyl)deca-1,3,5-trien-1-amine?
The InChIKey is VCFUJQSDZFFBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-4-5-6-7-8-9-10-11-12-15-13-14(2)3/h7-12,14-15H,4-6,13H2,1-3H3.
What are the key properties of N-(2-methylpropyl)deca-1,3,5-trien-1-amine?
N-(2-methylpropyl)deca-1,3,5-trien-1-amine has a molecular weight of 207.36 g/mol, XLogP of 4.05, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)deca-1,3,5-trien-1-amine is sourced from PubChem (CID 138986911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).