C13H21N3O6S2 — CID 138986955
(2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-prop-2-enylsulfanylpropan-2-yl]amino]-5-oxo-2-(sulfanylamino)pentanoic acid (PubChem CID 138986955) has the molecular formula C13H21N3O6S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-prop-2-enylsulfanylpropan-2-yl]amino]-5-oxo-2-(sulfanylamino)pentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-prop-2-enylsulfanylpropan-2-yl]amino]-5-oxo-2-(sulfanylamino)pentanoic acid |
|---|---|
| PubChem CID | 138986955 |
| Molecular Formula | C13H21N3O6S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-prop-2-enylsulfanylpropan-2-yl]amino]-5-oxo-2-(sulfanylamino)pentanoic acid |
| SMILES | C=CCSC[C@H](NC(=O)CC[C@H](NS)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H21N3O6S2/c1-2-5-24-7-9(12(20)14-6-11(18)19)15-10(17)4-3-8(16-23)13(21)22/h2,8-9,16,23H,1,3-7H2,(H,14,20)(H,15,17)(H,18,19)(H,21,22)/t8-,9-/m0/s1 |
| InChIKey | CMLPDBOPJOTDCA-IUCAKERBSA-N |
| XLogP | -0.74 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|