C22H10F4O2 — CID 138986975
4,5,6,7-tetrafluoro-1-naphthalen-1-ylnaphthalene-2,3-dicarbaldehyde (PubChem CID 138986975) has the molecular formula C22H10F4O2 and a molecular weight of 382.31 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-1-naphthalen-1-ylnaphthalene-2,3-dicarbaldehyde.
| Compound Name | 4,5,6,7-tetrafluoro-1-naphthalen-1-ylnaphthalene-2,3-dicarbaldehyde |
|---|---|
| PubChem CID | 138986975 |
| Molecular Formula | C22H10F4O2 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4,5,6,7-tetrafluoro-1-naphthalen-1-ylnaphthalene-2,3-dicarbaldehyde |
| SMILES | O=Cc1c(C=O)c(F)c2c(F)c(F)c(F)cc2c1-c1cccc2ccccc12 |
| InChI | InChI=1S/C22H10F4O2/c23-17-8-14-18(13-7-3-5-11-4-1-2-6-12(11)13)15(9-27)16(10-28)20(24)19(14)22(26)21(17)25/h1-10H |
| InChIKey | PFVWTMYZBNZYRC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|