About spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride
spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride (PubChem CID 138987524) has the molecular formula C9H16ClNO
and a molecular weight of 189.69 g/mol. Its IUPAC name is spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride.
Molecular Properties
| Compound Name | spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride |
| PubChem CID | 138987524 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride |
| SMILES | C1CC2(CCN1)OCC1CC12.Cl |
| InChI | InChI=1S/C9H15NO.ClH/c1-3-10-4-2-9(1)8-5-7(8)6-11-9;/h7-8,10H,1-6H2;1H |
| InChIKey | LZSPVJUJRHRHMY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride?
The IUPAC name of spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride (CID 138987524) is spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride.
What is the SMILES notation for spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride?
The canonical SMILES for spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride is C1CC2(CCN1)OCC1CC12.Cl.
What is the InChIKey of spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride?
The InChIKey is LZSPVJUJRHRHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO.ClH/c1-3-10-4-2-9(1)8-5-7(8)6-11-9;/h7-8,10H,1-6H2;1H.
What are the key properties of spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride?
spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride has a molecular weight of 189.69 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3-oxabicyclo[3.1.0]hexane-2,4'-piperidine];hydrochloride is sourced from PubChem (CID 138987524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).