About methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate
methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate (PubChem CID 138987540) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate |
| PubChem CID | 138987540 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate |
| SMILES | COC(=O)C1CC(OC)=NC1(C)C |
| InChI | InChI=1S/C9H15NO3/c1-9(2)6(8(11)13-4)5-7(10-9)12-3/h6H,5H2,1-4H3 |
| InChIKey | PZYMXHVDEKCZGW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate?
The IUPAC name of methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate (CID 138987540) is methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate.
What is the SMILES notation for methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate?
The canonical SMILES for methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate is COC(=O)C1CC(OC)=NC1(C)C.
What is the InChIKey of methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate?
The InChIKey is PZYMXHVDEKCZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-9(2)6(8(11)13-4)5-7(10-9)12-3/h6H,5H2,1-4H3.
What are the key properties of methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate?
methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate has a molecular weight of 185.22 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methoxy-2,2-dimethyl-3,4-dihydropyrrole-3-carboxylate is sourced from PubChem (CID 138987540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).