C11H8NNaO2S — CID 138987564
sodium 5-benzyl-1,3-thiazole-2-carboxylate (PubChem CID 138987564) has the molecular formula C11H8NNaO2S and a molecular weight of 241.25 g/mol. Its IUPAC name is sodium 5-benzyl-1,3-thiazole-2-carboxylate.
| Compound Name | sodium 5-benzyl-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 138987564 |
| Molecular Formula | C11H8NNaO2S |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | sodium 5-benzyl-1,3-thiazole-2-carboxylate |
| SMILES | O=C([O-])c1ncc(Cc2ccccc2)s1.[Na+] |
| InChI | InChI=1S/C11H9NO2S.Na/c13-11(14)10-12-7-9(15-10)6-8-4-2-1-3-5-8;/h1-5,7H,6H2,(H,13,14);/q;+1/p-1 |
| InChIKey | OMSJHDDYRCMXMN-UHFFFAOYSA-M |
| XLogP | -1.90 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |