About 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride
5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride (PubChem CID 138987607) has the molecular formula C7H9ClN4O
and a molecular weight of 200.63 g/mol. Its IUPAC name is 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride |
| PubChem CID | 138987607 |
| Molecular Formula | C7H9ClN4O |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride |
| SMILES | Cl.NCc1cc(=O)n2[nH]ccc2n1 |
| InChI | InChI=1S/C7H8N4O.ClH/c8-4-5-3-7(12)11-6(10-5)1-2-9-11;/h1-3,9H,4,8H2;1H |
| InChIKey | WGZWGAKTKVHTPI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride?
The IUPAC name of 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride (CID 138987607) is 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride.
What is the SMILES notation for 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride?
The canonical SMILES for 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride is Cl.NCc1cc(=O)n2[nH]ccc2n1.
What is the InChIKey of 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride?
The InChIKey is WGZWGAKTKVHTPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O.ClH/c8-4-5-3-7(12)11-6(10-5)1-2-9-11;/h1-3,9H,4,8H2;1H.
What are the key properties of 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride?
5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride has a molecular weight of 200.63 g/mol, XLogP of -0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrochloride is sourced from PubChem (CID 138987607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).