About 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile
2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile (PubChem CID 138987656) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile |
| PubChem CID | 138987656 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile |
| SMILES | COCc1cc(CC#N)no1 |
| InChI | InChI=1S/C7H8N2O2/c1-10-5-7-4-6(2-3-8)9-11-7/h4H,2,5H2,1H3 |
| InChIKey | AOKDSDBOIJLREM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile?
The IUPAC name of 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile (CID 138987656) is 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile.
What is the SMILES notation for 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile?
The canonical SMILES for 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile is COCc1cc(CC#N)no1.
What is the InChIKey of 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile?
The InChIKey is AOKDSDBOIJLREM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-10-5-7-4-6(2-3-8)9-11-7/h4H,2,5H2,1H3.
What are the key properties of 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile?
2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile has a molecular weight of 152.15 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(methoxymethyl)-1,2-oxazol-3-yl]acetonitrile is sourced from PubChem (CID 138987656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).