C5H12ClNO2 — CID 138987873
(1S,3R,4R)-4-aminocyclopentane-1,3-diol;hydrochloride (PubChem CID 138987873) has the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. Its IUPAC name is (1S,3R,4R)-4-aminocyclopentane-1,3-diol;hydrochloride.
| Compound Name | (1S,3R,4R)-4-aminocyclopentane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 138987873 |
| Molecular Formula | C5H12ClNO2 |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | (1S,3R,4R)-4-aminocyclopentane-1,3-diol;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C5H11NO2.ClH/c6-4-1-3(7)2-5(4)8;/h3-5,7-8H,1-2,6H2;1H/t3-,4+,5+;/m0./s1 |
| InChIKey | HISQDHHEVRZPBF-UJPDDDSFSA-N |
| XLogP | -0.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |