About 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride
5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride (PubChem CID 138987931) has the molecular formula C8H12ClNS
and a molecular weight of 189.71 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride |
| PubChem CID | 138987931 |
| Molecular Formula | C8H12ClNS |
| Molecular Weight | 189.71 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride |
| SMILES | Cl.NCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C8H11NS.ClH/c9-5-7-4-6-2-1-3-8(6)10-7;/h4H,1-3,5,9H2;1H |
| InChIKey | VLUOCYBUPTYWIT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride?
The IUPAC name of 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride (CID 138987931) is 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride.
What is the SMILES notation for 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride?
The canonical SMILES for 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride is Cl.NCc1cc2c(s1)CCC2.
What is the InChIKey of 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride?
The InChIKey is VLUOCYBUPTYWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS.ClH/c9-5-7-4-6-2-1-3-8(6)10-7;/h4H,1-3,5,9H2;1H.
What are the key properties of 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride?
5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride has a molecular weight of 189.71 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethanamine;hydrochloride is sourced from PubChem (CID 138987931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).