C20H21N5O2 — CID 138988468
3-[[1-(5-methylpyrazine-2-carbonyl)piperidin-4-yl]methyl]quinazolin-4-one (PubChem CID 138988468) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[[1-(5-methylpyrazine-2-carbonyl)piperidin-4-yl]methyl]quinazolin-4-one.
| Compound Name | 3-[[1-(5-methylpyrazine-2-carbonyl)piperidin-4-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 138988468 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-[[1-(5-methylpyrazine-2-carbonyl)piperidin-4-yl]methyl]quinazolin-4-one |
| SMILES | Cc1cnc(C(=O)N2CCC(Cn3cnc4ccccc4c3=O)CC2)cn1 |
| InChI | InChI=1S/C20H21N5O2/c1-14-10-22-18(11-21-14)20(27)24-8-6-15(7-9-24)12-25-13-23-17-5-3-2-4-16(17)19(25)26/h2-5,10-11,13,15H,6-9,12H2,1H3 |
| InChIKey | KXDSPCDTLKINPZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |