About 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide
1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide (PubChem CID 138989358) has the molecular formula C15H18N4O2
and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide |
| PubChem CID | 138989358 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2c(OC)ccc3c2CCC3)nn1 |
| InChI | InChI=1S/C15H18N4O2/c1-3-19-9-12(17-18-19)15(20)16-14-11-6-4-5-10(11)7-8-13(14)21-2/h7-9H,3-6H2,1-2H3,(H,16,20) |
| InChIKey | PEHAJVAAYJNBNM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide?
The IUPAC name of 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide (CID 138989358) is 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide.
What is the SMILES notation for 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide?
The canonical SMILES for 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide is CCn1cc(C(=O)Nc2c(OC)ccc3c2CCC3)nn1.
What is the InChIKey of 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide?
The InChIKey is PEHAJVAAYJNBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2/c1-3-19-9-12(17-18-19)15(20)16-14-11-6-4-5-10(11)7-8-13(14)21-2/h7-9H,3-6H2,1-2H3,(H,16,20).
What are the key properties of 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide?
1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide has a molecular weight of 286.34 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-(5-methoxy-2,3-dihydro-1H-inden-4-yl)triazole-4-carboxamide is sourced from PubChem (CID 138989358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).